16-Desoxycucurbitacin V
16-Desoxycucurbitacin V is a remarkable and powerful natural compound deeply explored in natural compound, having emerged as a captivating subject due to its multifaceted role in both the field of oncology and inflammation research. Being cherished for its extraordinary anticancer attributes, this natural compound exhibits exceptional potential in impeding the proliferation of diverse malignant cells, thereby unraveling new avenues for the research of formidable cancers such as lung, breast and colorectal cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7124 |
| Pricing | Inquire |
| Cas | 2081098-85-1 |
| Molecular Weight | 472.70 |
| Molecular Formula | C30H48O4 |
| Canonical SMILES | CC1(C(CCC2C1=CCC3C2(C(=O)CC4(C3(CCC4C(C)(CC=CC(C)(C)O)O)C)C)C)O)C |