5-Ethyl-3',5'-bis-(p-chlorobenzoyl)-2'-deoxyuridine
5-Ethyl-3',5'-bis-(p-chlorobenzoyl)-2'-deoxyuridine is a remarkable antiviral compound, used in research of herpes simplex virus (HSV) infections. By functioning as a nucleoside analog and effectively hampering viral DNA enhancement, it efficaciously obstructs viral replication. The distinctive structure of this compound renders it exceptionally promising for extensive biomedical exploration and drug development directed towards HSV-associated afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 25137-84-2 |
| Pricing | Inquire |
| Cas | 25137-84-2 |
| Molecular Weight | 533.36 |
| Molecular Formula | C25H22Cl2N2O7 |
| Canonical SMILES | CCC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(=O)C3=CC=C(C=C3)Cl)OC(=O)C4=CC=C(C=C4)Cl |