Ramelteon Impurity 21
Ramelteon Impurity 21 is an impurity of Ramelteon. Ramelteon is a potent and selective agonist at melatonin MT1/MT2 receptor. Ramelteon is a sleep agent medication used to treat sleeplessness (insomnia).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1092507-03-3 |
| Pricing | Inquire |
| Cas | 1092507-03-3 |
| Molecular Weight | 218.25 |
| Molecular Formula | C13H14O3 |
| Canonical SMILES | C1CC2=C(C1CC(=O)O)C3=C(C=C2)OCC3 |