Estatin B
Estatin B is a thiol protease inhibitor produced by Mycellophthora thermophila M4323. It has strong inhibitory activity of papain, fig protease and bromelain, but does not inhibit chymotrypsin, trypsin and pepsin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00875 |
| Pricing | Inquire |
| Cas | 106396-24-1 |
| Molecular Weight | 407.42 |
| Molecular Formula | C18H25N5O6 |
| Canonical SMILES | C1=CC(=CC=C1CC(C(=O)NCCCCN=C(N)N)NC(=O)C2C(O2)C(=O)O)O |