Tacrolimus EP Impurity G
Tacrolimus EP Impurity G is an impurity of Tacrolimus, which is a calcineurin inhibitor used as an immunosuppressant after organ transplantation to reduce the activity of the patient's immune system, thereby reducing the risk of organ rejection.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-05772 |
| Pricing | Inquire |
| Cas | 144490-63-1 |
| Molecular Weight | 804.04 |
| Molecular Formula | C44H69NO12 |
| Canonical SMILES | CC1CC(C2C(CC(C(O2)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C(CC(=O)C(C=C(C1)C)CC=C)O)C)C(=CC4CCC(C(C4)OC)O)C)O)C)OC)OC |