Pacidamycin 5
It is produced by the strain of Str. coeruleorubidus AB 1183F-64. It has inhibitory effect on Pseudomonas aeruginosa. It also has effect on a few strains of bacteria such as suppurative staphylococcus and Escherichia coli. Serum can reduce its antibacterial activity, pH also affects its antibacterial activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02336 |
| Pricing | Inquire |
| Cas | 122855-43-0 |
| Molecular Weight | 764.78 |
| Molecular Formula | C36H44N8O11 |
| Canonical SMILES | CC(C(C(=O)NC=C1CC(C(O1)N2C=CC(=O)NC2=O)O)NC(=O)C(C)NC(=O)NC(CC3=CC=CC=C3)C(=O)O)N(C)C(=O)C(CC4=CC(=CC=C4)O)N |