TC-DAPK 6
An oxazalone compound that acts as a potent, ATP-competitive, and highly selective death-associated protein kinase (DAPK) inhibitor (IC50 = 69 and 225 nM against DAPK1 and DAPK3, respectively, with 10 µM ATP), while exhibiting much reduced or no activity against a panel of 48 other kinases even at concentrations as high as 10 µM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 315694-89-4 |
| Pricing | Inquire |
| Cas | 315694-89-4 |
| Molecular Weight | 276.29 |
| Molecular Formula | C17H12N2O2 |
| Canonical SMILES | C1=CC=C(C=C1)C=CC2=NC(=CC3=CN=CC=C3)C(=O)O2 |