6-O-Benzoyl-D-glucal
6-O-Benzoyl-D-glucal, an indispensable chemical compound in the biomedical sector, demonstrates profound significance for synthesizing diverse pharmaceutical remedies. Its intricate framework and distinct attributes render it a potential breakthrough in combating ailments like cancer, diabetes, and inflammation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 58871-05-9 |
| Pricing | Inquire |
| Cas | 58871-05-9 |
| Molecular Weight | 250.25 |
| Molecular Formula | C13H14O5 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C=CO2)O)O |