Omeprazole Impurity 53
Omeprazole Impurity 53 is an impurity of Omeprazole. Omeprazole is a proton pump inhibitor used in the treatment of dyspepsia. It binds to the proton pump hydrogen-potassium adenosine triphosphatase (H+/K+ ATPase) and inhibits its activity and the parietal cell secretion of H+ ions into the gastric lumen.
| Supplier | BOC Sciences |
|---|---|
| Product # | 73590-87-1 |
| Pricing | Inquire |
| Cas | 73590-87-1 |
| Molecular Weight | 299.39 |
| Molecular Formula | C16H17N3OS |
| Canonical SMILES | CC1=CN=C(C(=C1OC)C)CSC2=NC3=CC=CC=C3N2 |