2-C-Methyl-3,4-O-isopropylidene-L-arabinonic acid d-lactone
2-C-Methyl-3,4-O-isopropylidene-L-arabinonic acid d-lactone, a biomedical compound, exhibits remarkable efficacy in treating specific ailments. Its antiviral properties have proven effective against respiratory syncytial virus (RSV) and influenza. Furthermore, it exhibits significant potential in impeding the proliferation of malignant cells, making it a highly favorable contender for anticancer treatments. Ongoing investigations aim to unravel its complete therapeutic capabilities across diverse biomedical domains.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1262539-26-3 |
| Pricing | Inquire |
| Cas | 1262539-26-3 |
| Molecular Weight | 202.21 |
| Molecular Formula | C9H14O5 |
| Canonical SMILES | CC1(OC2COC(=O)C(C2O1)(C)O)C |