Methyl 2-(7-Methyl-3-indolyl)-2-oxoacetate
Methyl 2-(7-Methyl-3-indolyl)-2-oxoacetate (CAS# 425640-13-7) is an intermediate used in the synthesis of 7-Methyltryptophol (M331800), which is a metabolite of Tryptophan (T947200), an essential amino acid.Also, it is used in the synthesis of 3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)-4-(indol-3-yl)-maleimides as potent, selective GSK-3β inhibitors and neuroprotective agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB025173 |
| Pricing | Inquire |
| Cas | 425640-13-7 |
| Molecular Weight | 217.22 |
| Molecular Formula | C12H11NO3 |
| Canonical SMILES | CC1=CC=CC2=C1NC=C2C(=O)C(=O)OC |