4-Keto Retinal
4-Keto Retinal is a crucial compound used in the research and development of biomedical applications primarily employed in studying cellular processes, signaling pathways and gene expression related to retinal diseases such as retinitis pigmentosa and age-related macular degeneration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 33532-44-4 |
| Pricing | Inquire |
| Cas | 33532-44-4 |
| Molecular Weight | 298.42 |
| Molecular Formula | C20H26O2 |
| Canonical SMILES | CC1=C(C(CCC1=O)(C)C)C=CC(=CC=CC(=CC=O)C)C |