Resveratrol-[d4]
Resveratrol-[d4] is the labelled analogue of Resveratrol. Resveratrol is a stilbenoid, a type of natural phenol, and a phytoalexin produced by several plants in response to injury or, when the plant is under attack by pathogens such as bacteria or fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012563 |
| Pricing | Inquire |
| Cas | 1089051-56-8 |
| Molecular Weight | 232.27 |
| Molecular Formula | C14H8D4O3 |
| Canonical SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |