Acetyl Pepstatin
| Supplier | Creative Peptides |
|---|---|
| Product # | R1048 |
| CAS # | 11076-29-2 |
| Pricing | Inquire |
| LabelingTarget | HIV-1 protease |
| BoilingPoint | 992.8±65.0 °C at 760 mmHg |
| MolecularFormula | C31H57N5O9 |
| MolecularWeight | 643.81 |
| Sequence | Ac-Val-Val-Sta-Ala-Sta-OH |
| Storage | -20°C |
| ShippingCondition | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |
| Explanation | Acetyl Pepstatin is an HIV-1 protease inhibitor (Ki = 20 nM at pH 4.7), also inhibits HIV-2 protease (Ki = 5 nM at pH 4.7). It shows antiviral property. |
| Activity | Inhibitor |
| InChI | InChI=1S/C31H57N5O9/c1-15(2)11-21(35-30(44)28(18(7)8)36-31(45)27(17(5)6)33-20(10)37)23(38)13-25(40)32-19(9)29(43)34-22(12-16(3)4)24(39)14-26(41)42/h15-19,21-24,27-28,38-39H,11-14H2,1-10H3,(H,32,40)(H,33,37)(H,34,43)(H,35,44)(H,36,45)(H,41,42)/t19-,21-,22-,23-,24-,27-,28-/m0/s1 |
| InChIKey | WKYBEGDEGRCZNF-LBTYKNIQSA-N |
| Solubility | Soluble in DMSO |
| IsomericSMILES | C[C@@H](C(=O)N[C@@H](CC(C)C)[C@H](CC(=O)O)O)NC(=O)C[C@@H]([C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)C)O |
| Appearance | Solid powder |
| Purity | >98% (or refer to the Certificate of Analysis) |
| ShortTermStorageConditions | Dry, dark and at 0 - 4 °C |
| LongTermStorageConditions | -20 °C |