Methyl 3-(Bromomethyl)-5-methylbenzoate
Methyl 3-(Bromomethyl)-5-methylbenzoate is an intermediate in the synthesis of RH 9886 (R315770), a pesticide derivative of Tebufenozide (T013200) is a synthetic nonsteroidal ecdysone agonist used in pesticide formulations (1) that causes premature molting; novel insect growth regulator (2,3,4) specific to lepidopteran species. Drinking water Contaminant Candidate List 3 (CCL3) as per United States Environmental Protection Agency (EPA). Environmental contaminants; Food contaminants.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB076264 |
| Pricing | Inquire |
| Cas | 120511-79-7 |
| Molecular Weight | 243.1 |
| Molecular Formula | C10H11BrO2 |
| Canonical SMILES | CC1=CC(=CC(=C1)C(=O)OC)CBr |