N4-Acetyl-5'-O-DMT-cytidine
N4-Acetyl-5'-O-DMT-cytidine is a prominent biochemical compound with antiviral properties, used for studying an array of viral afflictions. Its potency lies in its remarkable ability to impede the replication of distinct viral strains.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121058-82-0 |
| Pricing | Inquire |
| Cas | 121058-82-0 |
| Molecular Weight | 587.63 |
| Molecular Formula | C32H33N3O8 |
| Canonical SMILES | CC(=O)NC1=NC(=O)N(C=C1)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O)O |