Epi Lovastatin Hydroxy Acid-[d3] Sodium Salt
Epi Lovastatin Hydroxy Acid-[d3] Sodium Salt is the labelled analogue of Epi Lovastatin, which is an impurity of Lovastatin. Lovastatin is a statin medication, to treat high blood cholesterol and reduce the risk of cardiovascular disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005322 |
| Pricing | Inquire |
| Cas | 1329834-74-3 |
| Molecular Weight | 447.56 |
| Molecular Formula | C24H34D3NaO6 |
| Canonical SMILES | CCC(C)C(=O)OC1CC(C=C2C1C(C(C=C2)C)CCC(CC(CC(=O)[O-])O)O)C.[Na+] |