5'-O-DMT-2'-O-methylcytidine
5'-O-DMT-2'-O-methylcytidine is a biomedicine research product used for the treatment of viral infections, cancer, and neurological disorders. It acts as an antiviral and anticancer agent by inhibiting viral replication and tumor growth, respectively. Additionally, it also has neuroprotective properties that help in treating neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 103285-21-8 |
| Pricing | Inquire |
| Cas | 103285-21-8 |
| Molecular Weight | 559.62 |
| Molecular Formula | C31H33N3O7 |
| Canonical SMILES | COC1C(C(OC1N2C=CC(=NC2=O)N)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |