5'-Amino-2',5'-dideoxyuridine
5'-Amino-2',5'-dideoxyuridine is an imperative nucleoside analogue of significant relevance in the biomedical sector is effectively harnessed for addressing the ubiquitous viral diseases encompassing herpes and HIV. Distinguished by its remarkable characteristic, this compound effectively obstructs the progression of viral DNA synthesis through its adeptness at terminating replication chains. Moreover, its commendable antiviral attributes render it a promising candidate in the realm of therapeutic agent advancement, effectively countering the virulent onslaught of diverse viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35959-38-7 |
| Pricing | Inquire |
| Cas | 35959-38-7 |
| Molecular Weight | 227.22 |
| Molecular Formula | C9H13N3O4 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=O)NC2=O)CN)O |