7,10-Dioxa-2,5-diazaundecanoic acid, 4,9-dioxo-11-phenyl-, 9H-fluoren-9-ylmethyl ester
Presenting the 4,9-dioxo-11-phenylundecanoic acid derivative – a crucial component in biomedicine. This chemical compound boasts remarkable potential as a foundational structure for synthesizing an array of medicinal drugs, particularly for the treatment of cancer and inflammation-associated ailments. Its value cannot be overstated, as it serves as a vital building block in pharmaceutical research and development.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-006408 |
| Pricing | Inquire |
| Cas | 1599440-07-9 |
| Molecular Weight | 474.5 |
| Molecular Formula | C27H26N2O6 |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)COCNC(=O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |