Morpholino T monomer
Morpholino T monomer is an indispensable constituent in the research of antisense oligonucleotide therapeutics. As an elemental unit, it actively participates in the fabrication of tailored nucleic acids, skillfully aimed at studying inherited disorders, viral afflictions and malignant tumors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1155373-34-4 |
| Pricing | Inquire |
| Cas | 1155373-34-4 |
| Molecular Weight | 609.05 |
| Molecular Formula | C31H34ClN4O5P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CN(CC(O2)COP(=O)(N(C)C)Cl)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5 |