Phenyl b-D-thiogalactopyranoside
Phenyl b-D-thiogalactopyranoside is a biochemical compound widely used in the biomedical industry as a substrate for β-galactosidase activity assays. It mimics lactose and induces the expression of lac operon in E. coli.
| Supplier | BOC Sciences |
|---|---|
| Product # | 16758-34-2 |
| Pricing | Inquire |
| Cas | 16758-34-2 |
| Molecular Weight | 272.32 |
| Molecular Formula | C12H16O5S |
| Canonical SMILES | C1=CC=C(C=C1)SC2C(C(C(C(O2)CO)O)O)O |