2-METHYLINDAZOLE-6-BORONICACID
2-METHYLINDAZOLE-6-BORONICACID is a valuable compound widely used in the biomedical industry. This product is utilized as a key intermediate in the synthesis of potential drugs for treating various diseases including cancer and inflammatory disorders. Its unique boronic acid functionality enables it to participate in diverse chemical reactions, making it an indispensable tool for medicinal chemistry research and drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1001907-57-8 |
| Pricing | Inquire |
| Cas | 1001907-57-8 |
| Molecular Formula | C8H9BNO2 |
| Canonical SMILES | B(C1=CC2=NN(C=C2C=C1)C)(O)O |