Kanamycin A
Kanamycin is an aminoglycoside antibiotic that has inhibitory effects on gram-positive and negative bacteria and mycoplasma. It can be used for the prevention and treatment of chicken pullorum, colibacillosis, enteritis and other diseases, and has a significant effect on systemic sepsis, respiratory tract infection, peritonitis, etc. caused by drug-resistant bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01884 |
| Pricing | Inquire |
| Cas | 59-01-8 |
| Molecular Weight | 484.50 |
| Molecular Formula | C18H36N4O11 |
| Canonical SMILES | C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N |