Methyl 4-O-[4,6-O-benzylidene)-b-D-galactopyranosyl] b-D-glucopyranoside
Methyl 4-O-[4,6-O-benzylidene)-b-D-galactopyranosyl] b-D-glucopyranoside is a biomedical ingredient serving as a precursor or intermediate for the synthesis of glycosides and glycoconjugates. This compound may be utilized in drug development for studying various conditions related to carbohydrate metabolism or diseases influenced by glycan structures.
| Supplier | BOC Sciences |
|---|---|
| Product # | 56865-31-7 |
| Pricing | Inquire |
| Cas | 56865-31-7 |
| Molecular Weight | 444.43 |
| Molecular Formula | C20H28O11 |
| Canonical SMILES | COC1C(C(C(C(O1)CO)OC2C(C(C3C(O2)COC(O3)C4=CC=CC=C4)O)O)O)O |