Cyanidin-3-O-rhamnoside chloride
Cyanidin-3-O-rhamnoside chloride is a potent compound found in various fruits and vegetables. Utilized in the biomedical industry, it exhibits antioxidant and anti-inflammatory properties, making it a potential treatment for chronic diseases such as cardiovascular disorders and cancer. With its ability to scavenge free radicals and modulate cellular signaling pathways, this compound holds promise for therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38533-30-1 |
| Pricing | Inquire |
| Cas | 38533-30-1 |
| Molecular Weight | 468.84 |
| Molecular Formula | C21H21O10Cl |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=CC3=C(C=C(C=C3[O+]=C2C4=CC(=C(C=C4)O)O)O)O)O)O)O.[Cl-] |