2'-Deoxyguanosine-5'-O-(1-Thiotriphosphate)
2'-Deoxyguanosine-5'-O-(1-Thiotriphosphate) is an indispensable compound primarily employed in nucleic acid exploration, assuming a pivotal position as a fundamental constituent for the construction of altered DNA strands. Remarkably influential, this compound facilitates comprehensive examination of DNA replication, transcription, and translation mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 80902-28-9 |
| Pricing | Inquire |
| Cas | 80902-28-9 |
| Molecular Weight | 523.20 |
| Molecular Formula | C10H16N5O12P3S |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)COP(=S)(O)OP(=O)(O)OP(=O)(O)O)O |