D-Mannose-6-O-sulphate sodium salt
D-Mannose-6-O-sulphate sodium salt, an influential biomedical agent, exhibits remarkable efficacy against a spectrum of viral infections like herpes simplex and cytomegalovirus. With its ability to impede viral adhesion to host cells, it curtails viral proliferation effectively. Additionally, owing to its potent anti-inflammatory attributes, there lies a promising avenue for employing this compound in mitigating inflammatory ailments encompassing arthritis and asthma.
| Supplier | BOC Sciences |
|---|---|
| Product # | 204575-08-6 |
| Pricing | Inquire |
| Cas | 204575-08-6 |
| Molecular Weight | 282.20 |
| Molecular Formula | C6H11O9SNa |
| Canonical SMILES | C(C(C(C(C(C=O)O)O)O)O)OS(=O)(=O)[O-].[Na+] |