4-C-[[(Methylsulfonyl)oxy]methyl]-3-O-benzyl-1,2-di-O-acetyl 5-methanesulfonate D-erythro-pentofuranose
4-C-[[(Methylsulfonyl)oxy]methyl]-3-O-benzyl-1,2-di-O-acetyl 5-methanesulfonate D-erythro-pentofuranose, known for its intricate molecular architecture, serving as a remarkable biopharmaceutical agent. Its application lays in the research of distinct intracellular mechanisms implicated in ailments encompassing neoplastic growth, inflammatory responses and cerebral dysfunctions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 293751-03-8 |
| Pricing | Inquire |
| Cas | 293751-03-8 |
| Molecular Weight | 510.53 |
| Molecular Formula | C19H26O12S2 |
| Canonical SMILES | CC(=O)OC1C(C(OC1OC(=O)C)(COS(=O)(=O)C)COS(=O)(=O)C)OCC2=CC=CC=C2 |