7-methoxy-8-hydroxy-4-phenylcoumarin
7-methoxy-8-hydroxy-4-phenylcoumarin is an incredibly natural compound with tremendous potential in the field of oncology research. Through its nuanced chemical composition, this natural compound effectively impedes the proliferation of cancer cells by skillfully inhibiting pivotal enzymes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24258-36-4 |
| Pricing | Inquire |
| Cas | 24258-36-4 |
| Molecular Weight | 268.26 |
| Molecular Formula | C16H12O4 |
| Canonical SMILES | COC1=C(C2=C(C=C1)C(=CC(=O)O2)C3=CC=CC=C3)O |