Epelmycin D
It is produced by the strain of Streptomyces violaceus A262. It has anti-gram positive, negative bacteria and candida albicans activity, and has anti-leukemic L1210 activity, which is stronger than Aclacinomycin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01239 |
| Pricing | Inquire |
| Cas | 107807-22-7 |
| Molecular Weight | 585.60 |
| Molecular Formula | C30H35NO11 |
| Canonical SMILES | CCC1(CC(C2=C(C1C(=O)OC)C(=C3C(=C2O)C(=O)C4=C(C3=O)C=CC=C4O)O)OC5CC(C(C(O5)C)O)N(C)C)O |