Memantine Impurity IV
Memantine Impurity IV is an impurity of memantine. Memantine, also called Namenda, a N-methyl D-aspartate (NMDA) antagonist prescribed to treat symptoms of moderate to severe Alzheimer's, blocks the toxic effects associated with excess glutamate and regulates glutamate activation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 63971-25-5 |
| Pricing | Inquire |
| Cas | 63971-25-5 |
| Molecular Weight | 195.30 |
| Molecular Formula | C12H21NO |
| Canonical SMILES | CC12CC3(CC(C1)(CC(C2)(C3)O)N)C |