(+)-Biotin 4-amidobenzoic acid sodium salt
(+)-Biotin 4-amidobenzoic acid sodium salt is a crucial compound used in the biomedical industry. It acts as a precursor for designing novel drugs targeting biotin-dependent enzymes, aiding in the treatment of various disorders related to biotin deficiencies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 102418-74-6 |
| Pricing | Inquire |
| Cas | 102418-74-6 |
| Molecular Weight | 385.41 |
| Molecular Formula | C17H20N3NaO4S |
| Canonical SMILES | C1C2C(C(S1)CCCCC(=O)NC3=CC=C(C=C3)C(=O)[O-])NC(=O)N2.[Na+] |