6-O-Triisopropylsilyl-D-galactal
6-O-Triisopropylsilyl-D-galactal, a frequently employed compound, holds significance for its role in the research and development of drugs based on carbohydrates. Serving as a safeguarding entity for hydroxyl groups, it aids in the development of pharmaceutical substances specifically designed to combat a wide range of ailments such as cancer and diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 166021-01-8 |
| Pricing | Inquire |
| Cas | 166021-01-8 |
| Molecular Weight | 302.48 |
| Molecular Formula | C15H30O4Si |
| Canonical SMILES | CC(C)[Si](C(C)C)(C(C)C)OCC1C(C(C=CO1)O)O |