Hydrocortisone Impurity M
11-Epihydrocortisone is an isomer of Hydrocortisone, a glucocorticord which functions primarily to increase blood sugar through gluconeogenesis, suppression of immune system and aid in fat, protein and carbohydrate metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 566-35-8 |
| Pricing | Inquire |
| Cas | 566-35-8 |
| Molecular Weight | 362.46 |
| Molecular Formula | C21H30O5 |
| Canonical SMILES | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4(C(=O)CO)O)C)O |