Etomidate Impurity C HCl
An impurity of Etomidate. Etomidate is a short-acting intravenous anaesthetic agent used for the induction of general anaesthesia and sedation for short procedures such as reduction of dislocated joints, tracheal intubation, and cardioversion.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66512-39-8 |
| Pricing | Inquire |
| Cas | 66512-39-8 |
| Molecular Weight | 258.32 36.46 |
| Molecular Formula | C15H18N2O2 HCl |
| Canonical SMILES | CC(C)OC(=O)C1=CN=CN1C(C)C2=CC=CC=C2.Cl |