Talisomycin B
Tallysomycin B is a glycopeptide antibiotic produced by the rare actinomycete No. E 465-94. It has anti-gram-positive bacteria and gram-negative bacteria and fungi activity. It can induce lysogenic E. coli W1709 (A) to release phage.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03100 |
| Pricing | Inquire |
| Cas | 65057-91-2 |
| Molecular Weight | 1603.69 |
| Molecular Formula | C62H98N20O26S2 |
| Canonical SMILES | CC1C(C(C(C(O1)OC(C(C2=NC(=CS2)C3=NC(=CS3)C(=O)NCCCNCCCCN)O)NC(=O)C(C(C)O)NC(=O)CC(C(C)NC(=O)C(C(C4=CN=CN4)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)OC(=O)N)O)NC(=O)C7=C(C(=NC(=N7)C(CC(=O)N)NCC(C(=O)N)N)N)C)O)O)O)N |