O-Methylisourea hemisulfate salt
O-Methylisourea Hemisulfate was used as a reagent in the preparation of (D,L)-arginine methyl ester analogs which display antiarrhythmic actiivity. It was also used in the synthesis of ethyl [6-methyl-2-methoxy-3-(substituted phenylethanone)-4-(substituted phenyl)]-1,2,3,4-tetrahydropyrimidine-5-carboxylates which display antimicrobial activity towards mycobacterium tuberculosis, staphylococcus aureus and bacillus subtilis at varying conentration ranges.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52328-05-9 |
| Pricing | Inquire |
| Cas | 52328-05-9 |
| Molecular Weight | 123.12 |
| Molecular Formula | C4H14N4O6S |
| Canonical SMILES | COC(=N)N.COC(=N)N.OS(=O)(=O)O |