(S)-2-(2-((6-Amino-1-((4-(hydroxymethyl)phenyl)amino)-1-oxohexan-2-yl)amino)-2-oxoethoxy)acetic acid
(S)-2-(2-((6-Amino-1-((4-(hydroxymethyl)phenyl)amino)-1-oxohexan-2-yl)amino)-2-oxoethoxy)acetic acid is a potent pharmaceutical compound used in the biomedical industry for the drug development of various diseases. Extensively researched and tested, it exhibits remarkable efficacy in targeting specific drug receptors and combating conditions like cancer, autoimmune disorders, and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01618 |
| Pricing | Inquire |
| Molecular Weight | 367.40 |
| Molecular Formula | C17H25N3O6 |
| Canonical SMILES | O=C(O)COCC(NC(CCCCN)C(NC1=CC=C(CO)C=C1)=O)=O |