Boc-1-aminocyclopropane-1-carboxylic acid
Boc-1-aminocyclopropane-1-carboxylic acid is used as a reagent in the synthesis of pyrrolotriazinone derivatives as therapeutic PI3K inhibitors. Also used as a reagent in the synthesis of ether, carbamate and ester derivatives of adarotene as potential antitumor agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-007939 |
| Pricing | Inquire |
| Cas | 88950-64-5 |
| Molecular Weight | 201.22 |
| Molecular Formula | C9H15NO4 |
| Canonical SMILES | CC(C)(C)OC(=O)NC1(CC1)C(=O)O |