ML 210
ML 210 is a selective RAS inhibitor that kills cells induced to express mutant RAS. ML210 exhibits nanomolar potency against two HRASG12V expressing cell lines and 4-fold selectivity against two control cell lines not expressing HRASG12V.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1360705-96-9 |
| Pricing | Inquire |
| Cas | 1360705-96-9 |
| Molecular Weight | 475.32 |
| Molecular Formula | C22H20Cl2N4O4 |
| Canonical SMILES | CC1=C(C(=NO1)C(=O)N2CCN(CC2)C(C3=CC=C(C=C3)Cl)C4=CC=C(C=C4)Cl)[N+](=O)[O-] |