(R)-Usnic acid
It is a naturally occurring dibenzofuran derivative found in several lichen species. It is a potent antibiotic effective against Gram-positive bacteria, Mycobacterium tuberculosis, and some pathogenic fungi. It exhibits activities of antiviral, antiprotozoal, antimitotic, anti-inflammatory, and analgesic.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4631 |
| Pricing | Inquire |
| Cas | 7562-61-0 |
| Molecular Weight | 344.32 |
| Molecular Formula | C18H16O7 |
| Canonical SMILES | CC1=C(C(=C2C(=C1O)C3(C(=CC(=O)C(C3=O)C(=O)C)O2)C)C(=O)C)O |