8-Oxo-2'-deoxyadenosine
8-Oxo-2'-deoxyadenosine is a crucial product in the biomedical industry used for studying and treating oxidative DNA damage caused by reactive oxygen species. It is a modified form of the nucleoside adenosine and serves as a biomarker for DNA damage and oxidative stress-related diseases like cancer, neurodegenerative disorders, and cardiovascular diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 62471-63-0 |
| Pricing | Inquire |
| Cas | 62471-63-0 |
| Molecular Weight | 267.24 |
| Molecular Formula | C10H13N5O4 |
| Canonical SMILES | C1C(C(OC1N2C3=NC=NC(=C3NC2=O)N)CO)O |