5'-Fluoro-5'-deoxy-adenosine
5'-Fluoro-5'-deoxy-adenosine is an impressive antiviral compound, exhibiting inhibitory efficacy in studying an array of viral afflictions including influenza, herpes and HIV. This compound, revered for its impeccable inhibitory capabilities restraining viral replication while thwarting viral dissemination, emerges as an auspicious contender for the development of avant-garde antiviral researchs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 731-98-6 |
| Pricing | Inquire |
| Cas | 731-98-6 |
| Molecular Weight | 269.23 |
| Molecular Formula | C10H12FN5O3 |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CF)O)O)N |