tert-Butyl phenyl carbonate
tert-Butyl phenyl carbonate (CAS# 6627-89-0) is used in the synthesis of carbamate protected polyamines as well as in the preparation of small molecule inhibitors of acetyl-CoA carboxylase 1 and 2 modulating long chain fatty acid biosynthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6627-89-0 |
| Pricing | Inquire |
| Cas | 6627-89-0 |
| Molecular Weight | 194.23 |
| Molecular Formula | C11H14O3 |
| Canonical SMILES | CC(C)(C)OC(=O)OC1=CC=CC=C1 |