1,2,3,4-Tetrahydro-7-methoxy-1-naphthalenol 1-Acetate
1,2,3,4-Tetrahydro-7-methoxy-1-naphthalenol 1-Acetate, is α-Τetralols derivative, and are versatile homochiral building blocks in organic synthesis. They can also be used for asymmetric synthesis of natural products such as Mutisianthol and Flossonol.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB056822 |
| Pricing | Inquire |
| Cas | 945853-23-6 |
| Molecular Weight | 220.26 |
| Molecular Formula | C13H16O3 |
| Canonical SMILES | CC(=O)OC1CCCC2=C1C=C(C=C2)OC |