1,2-Bis(4-methoxyphenyl)-2-oxoethyl Cyclohexylcarbamate
1,2-Bis(4-methoxyphenyl)-2-oxoethyl Cyclohexylcarbamate is a pharmaceutical intermediate often used in the production of potent drugs. Primarily, it is associated with the synthesis of therapeutic agents targeting inflammatory conditions such as rheumatoid arthritis, and certain types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 196599-80-1 |
| Pricing | Inquire |
| Cas | 196599-80-1 |
| Molecular Weight | 397.47 |
| Molecular Formula | C23H27NO5 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)OC)OC(=O)NC3CCCCC3 |