2C-Hydroxymethyl-2,3:5,6-di-O-isopropylidene-D-mannono-1,4-lactone
2C-Hydroxymethyl-2,3:5,6-di-O-isopropylidene-D-mannono-1,4-lactone, an immensely powerful biomedicine, finds utility in the management of multifarious ailments. Remarkably, this compound showcases exceptional antifungal and antibacterial attributes, rendering it an invaluable ally against deleterious fungal and bacterial afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70147-48-7 |
| Pricing | Inquire |
| Cas | 70147-48-7 |
| Molecular Weight | 288.29 |
| Molecular Formula | C13H20O7 |
| Canonical SMILES | CC1(OCC(O1)C2C3C(C(=O)O2)(OC(O3)(C)C)CO)C |