4'-a-C-Methyladenosine
4'-a-C-Methyladenosine, a compound of immense significance in the biomedical field, finds widespread application. Its therapeutic potential in combating cancer, neurodegenerative ailments, and viral infections renders it indispensable. Remarkably, this product exhibits promise by impeding tumor proliferations and metastasis, augmenting cognitive abilities, and thwarting viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 152540-76-6 |
| Pricing | Inquire |
| Cas | 152540-76-6 |
| Molecular Weight | 281.27 |
| Molecular Formula | C11H15N5O4 |
| Canonical SMILES | CC1(C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O)CO |