Entacapone 3-b-D-glucuronide
Entacapone 3-b-D-glucuronide is a metabolite of Entacapone, which is a selective and reversible inhibitor of the enzyme catechol-O-methyltransferase (COMT) used in combination with other medications for the treatment of Parkinson's disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 158069-75-1 |
| Pricing | Inquire |
| Cas | 158069-75-1 |
| Molecular Weight | 481.41 |
| Molecular Formula | C20H23N3O11 |
| Canonical SMILES | CCN(CC)C(=O)C(=CC1=CC(=C(C(=C1)OC2C(C(C(C(O2)C(=O)O)O)O)O)O)[N+](=O)[O-])C#N |